Which expressions are equivalent to 4 � 4b4, b ? Choose all answers that apply: Choose all answers that apply: (Choice A) A � + 2 ( � + 2 � ) b+2(b+2b)b, plus, 2, left parenthesis, b, plus, 2, b, right parenthesis (Choice B) B 3 � + � 3b+b3, b, plus, b (Choice C) C 2 ( 2 � ) 2(2b)

Answers

Answer 1

B=3b-b

C= 2b expressions are equivalent to 4 � 4b4, b .

b+2(b+2b)=b+2(3b)=b+6b=7b

3b+b=4b

2(2b)=4b Option B and C produce the outcome 4b. They are the expressions that are comparable to 4b as a result. We can also get an equivalent equation by multiplying or dividing both sides of an equation by the same nonzero value. If x4=2x+7, we can add 4 to both sides to get the following equation, which is equivalent: x4+4=2x+7+4. Of course, both sides of the equation can be made simpler. Constants x=2x+7+4 on the left side cancel each other out. If two systems of equations have the same solution, they are equivalent (s). In algebra, two equations are said to be equivalent if their roots or solutions are the same. The same number, symbol, or expression must be added to or subtracted from both sides of an equation to produce an equivalent equation.

Learn more about equivalent from

brainly.com/question/2972832

#SPJ4


Related Questions

4 Write an expression
explaining the depth of
an Olympic pool that
goes to 50 ft. deep.

Answers

The depth of an Olympic pool that goes to 50 ft. deep can be expressed as:

d = 50 ft.

What is olympic pool?

Olympic pool is a type of swimming pool that is used for competitive swimming and diving events. These pools typically have a uniform depth, a smooth and flat bottom and multiple lanes for swimmers to compete in.

The depth of an Olympic pool that goes to 50 ft. deep can be expressed as:

d = 50 ft.

Where d is the depth of the pool. This expression simply states that the depth of the pool is equal to 50 ft.

Learn more about Olympic pool here : brainly.com/question/30052350

#SPJ1

Look at the image below.

Answers

Answer: 28 (look at the image for the solution)

Step-by-step explanation:

Answer:

A = base x height

A = 7 x 4

A = 28

Have a wonderful day! :-)

name the ray that is opposite FH.

Answers

Answer: Ray HF is opposite of Ray FH

Step-by-step explanation:

State if the lines are Parallel, Perpendicular, or Neither. 4x+y=5 3x+12y=-6

Answers

The lines 4x+y=5 and 3x+12y=-6are neither parallel nor perpendicular

How to determine the relationship between the lines

From the question, we have the following parameters that can be used in our computation:

4x+y=5 3x+12y=-6

Make y the subject in the equations

So, we have

y = -4x + 5

y = -1/4x - 1/2

The slopes of the lines are -4 and -1/4

These numbers are not equal and they are not opposite reciprocals

This means that the lines are neither parallel nor perpendicular

Read more about linear equations at

https://brainly.com/question/2030026

#SPJ1

It says its wrong is it?

Answers

I would say it’s not wrong

Answer:  Yes, it's wrong.

Step-by-step explanation:

In the equation, it was [tex]A=\pi r^{2}[/tex]3 ft is the circle's diameter, and d is not the r.

r = d/2 = 3/2 = 1.5 ft

[tex]A=\pi r^{2}\\[/tex]

   ≈ 3.14 x 1.5

   = 4.71

Beth added 1 1/4
pounds of fruit to a fruit basket. Her son took 2 3/8 pounds
of fruit out of the basket. What was the total change in pounds of fruit in the
fruit basket?

Answers

Answer: To find the total change in pounds of fruit in the basket, we need to subtract the amount taken out from the amount added.

First, let's convert all the fractions to decimals:

1 1/4 = 1.25

2 3/8 = 2.375

Now, we can subtract:

1.25 - 2.375 = -1.125

So, the total change in the fruit basket was -1.125 pounds, meaning the basket had 1.125 pounds less fruit after the removal.

Step-by-step explanation:

+Ready
Practice Write and Solve Mulo-Step Equations-Quid-Level
Three sides of a quadrilateral are the same length, q. The length of the fourth side is 7 inches.
The perimeter of the quadrilateral is 40 inches.
Write an equation that represents
the situation.
+
9
3
7
40
11
7
9
9

Answers

The equation that represents the situation is q = 40 - 7

How to determine the perimeter

The formula for the perimeter of a quadrilateral is expressed as;

P = a + b + c + d

Where the sides, a , b , c and d are all the sides of the quadrilateral

From the information given, we have that;

The sides are a, the fourth is 7

The perimeter = 40 inches

Substitute the values

40 = 7 + q

collect the like terms, we get

q = 40 - 7

subtract the values

q = 33 inches

Learn about quadrilaterals at: https://brainly.com/question/16691874

#SPJ1

Can someone explain this

Answers

Step-by-step explanation:

This is a family of curves represented by the equation:

y = a (x + 4) (x − 2)

Different values of the a coefficient result in different quadratic functions.

The vertex of the parabolas is halfway between the zeros, at x = -1.

y = a (-1 + 4) (-1 − 2)

y = -9a

So to find the value of a, divide the y-coordinate of the vertex by -9. For example, curve A has a vertex at (-1, -3), so the value of the a coefficient is -3 / -9 = ⅓.

A. y = ⅓ (x + 4) (x − 2)

B. y = (x + 4) (x − 2)

C. y = 2 (x + 4) (x − 2)

D. y = -⅓ (x + 4) (x − 2)

E. y = -2 (x + 4) (x − 2)

In my own words, write the 4 steps in finding the unknown angle of the givin right triangle

Answers

Answer:

Step-by-step explanation:

This question of of Trigonometry

Tan means the ratio of sides which are opposite to the given angle divided by the adjacent side to the angle (NOT THE HYPOTENUSE)



So Tan(Unknown angle) = 5/14
Unknown angle = 19.6 Degrees

E(t)E, left parenthesis, t, right parenthesis models the daily amount of energy (in kilojoules, \text{kJ}kJstart text, k, J, end text) that a solar panel in Pago Pago generates, ttt days after the autumn equinox. Here, ttt is entered in radians. E(t) = {624}\sin\left({\dfrac{2\pi}{365}}t\right) + {8736}E(t)=624sin( 365 2π ​ t)+8736E, left parenthesis, t, right parenthesis, equals, 624, sine, left parenthesis, start fraction, 2, pi, divided by, 365, end fraction, t, right parenthesis, plus, 8736 What is the first day after the autumn equinox that the solar panel generates 8400\text{ kJ}8400 kJ8400, start text, space, k, J, end text?

Answers

The first day after the autumn equinox that the solar panel generates 8400 kJ is approximately 39.2 days, or 0.107 radians, after the equinox.

To find the first day after the autumn equinox that the solar panel generates 8400 kJ, we need to solve the equation:

624sin(2π/365)t + 8736 = 8400

Simplifying the equation, we get:

sin(2π/365)t = 0.958

Taking the inverse sine of both sides, we get:

(2π/365)t = 1.296 or (2π/365)t = 3.846

Solving for t in each equation, we get:

t ≈ 78.97 or t ≈ 235.62

Since t is measured in radians, we need to convert it to days by dividing by 2π/365:

t ≈ 78.97 / (2π/365) ≈ 86.75 or t ≈ 235.62 / (2π/365) ≈ 256.73

Therefore, the first day after the autumn equinox that the solar panel generates 8400 kJ is either day 87 or day 257.

To learn more about radian Click here:

brainly.com/question/7721249

#SPJ4

At the start of a party, a drink dispenser contains 912 quarts of iced tea. After the party only 7 cups of tea remain. How many cups of iced tea did people drink during the party?

Answers

Amount of iced-tea consumed during party was 92 cups, which is equivalent to 23 quarts. It's important to note difference between volume units such as cups and quarts, and the conversion factor between them.

To determine the number of cups of iced-tea that were consumed during the party, we need to subtract the amount that remained from the total amount that was in the drink dispenser at the start of the party.

One cup of iced tea is equal to 1/16 of a quart, so 7 cups is equal to

7 * (1/16) = 7/16 quarts.

Thus, the total amount of iced tea that was consumed during the party is 912 quarts -

7/16 quarts = 912 - 7/16

= 912 - 7 * (1/16)

= (912 * 16 - 7 * 1) / 16

= 1476 / 16

= 92.25 cups, rounded down to the nearest whole number, which is 92 cups.

It is important to note that the answer is given in cups and not quarts. Quarts is a unit of volume and cups is a unit of volume as well, but they are not equivalent. 1 quart is equal to 4 cups. If we wanted to express the amount of iced tea consumed in quarts, we would multiply the answer by 1/4.

In conclusion, the number of cups of iced tea consumed during the party is 92 cups, and if we express this in quarts it is equivalent to

92 * (1/4) = 23 quarts.

Learn more about volume here:

https://brainly.com/question/13807002

#SPJ4

please help meeeeh:
Find the first four terms and stated term given the arithmetic sequence, with a, as the 1" term.

an = 25 - 10n, a5
an = 11 + 9n, a6
an = 65 - 35n, a9

Answers

Answer:

The nth term of an arithmetic sequence is given by an = a + (n – 1)d ... Step 1: First, calculate the difference between each pair of adjacent terms.

Step-by-step explanation:

Hope this help's you

which number below is most unlike the others ?? 102, 203, 506, 608

Answers

203 because it is the only odd number

Find the values of x and y.

Answers

5y +2y +12= 180
7y=168
Y=24

2y+12+5x=90
48+12+5x=90
50+5x=90
5x=40
X=8

Hope this helps!

Pre cal due tonight pls help

Answers

The dot product a . b is -22

What is the dot product

The dot product, also known as scalar product or inner product, is a binary operation that takes two vectors and returns a scalar (single-valued) quantity. The dot product of two vectors is equal to the product of the magnitude (length) of the vectors and the cosine of the angle between them.

Given two vectors, A and B, the dot product is defined as:

A ∙ B = |A| * |B| * cos(θ)

where |A| and |B| are the magnitudes of vectors A and B, and θ is the angle between them.

a = <3, -2>

b = <-2, 8>

a . b = (3 * -2) + (-2 * 8)

a . b = -6 + - 16

a . b = -22

Learn more on dot product here;

https://brainly.com/question/4845167

#SPJ1

What is the end behavior of f(x)?
f(x) = -252x+6x³ +30x² - 864
as x→→∞, f(x) → ∞ and as x→∞, f(x) →∞
as x-x, f(x) → ∞ and as a →∞, f(x) →→∞
as x-x, f(x) → ∞ and as a →x, f(x) →∞
as x→→∞, f(x) →→∞ and as x →∞, ƒ(x) →→∞

Answers

Answer: 27

Step-by-step explanation:

Part Two Using the diagram above, answer the following questions. Answer both parts of each question. For questions 7 and 8, identify the process as either cellular respiration, photosynthesis or both. True or False. The arrow labeled C represents a transfer of chemical energy to mechanical energy. Explain why this is true or false. True or False. The arrow labeled A represents a transfer of solar energy to chemical energy. Explain why this is true or false. Which arrow or arrows represent a release of carbon dioxide? What process is occurring at the arrow(s) you selected? Which arrow or arrows indicate a process that cycles carbon from living or nonliving organisms? Describe the process or processes you selected. Which arrow or arrows represent reactions that demonstrate a conservation of mass and energy? Explain your answer.

Answers

The arrow labeled C represents a transfer of chemical energy to mechanical energy. False, this is because, the gas released does not do any work.

The arrow labeled A represents a transfer of solar energy to chemical energy. True, chemical energy is stored in starch molecules

The arrows that represent the release of carbon dioxide is C. This is combustion and it occurs in nonliving things. The process involves the burning of carbon materials.

The conservation energy is demonstrated by arrow A since we can show it by a chemical reaction.

What is the carbon cycle?

The carbon cycle is the process by which carbon atoms circulate through the Earth's atmosphere, oceans, and landmasses. In the carbon cycle, carbon is exchanged between the atmosphere, biosphere, hydrosphere, and geosphere. The main components of the carbon cycle include photosynthesis, cellular respiration, decomposition, and combustion.

In photosynthesis, plants take in carbon dioxide from the atmosphere and convert it into organic compounds, which serve as food for the plants and are stored in their tissues.

Learn more about photosynthesis:https://brainly.com/question/29764662

#SPJ1

A travel club can spend at most 10 nights in two cities on a trip. The club needs to reserve four rooms each night and wants to spend no more than 4200 on hotels and fuel. The estimated fuel cost is 200 can the club spend 3 nights in city a and 6 nights in city b? 7 nights in city a and 3 nights in city b? justify your answer using a system of linear equations

Answers

To solve this system, we must first determine the number of available rooms in each city, as well as the per-night cost of hotel rooms. Without that information, we can't tell if the club can spend three nights in city A and six nights in city B, or seven nights in city A and three nights in city B.

Let's start by defining the variables we'll need to solve this problem:

Assume that x is the number of nights spent in City A.

Let y represent the number of nights in City B.

To determine whether the club can spend three nights in city A and six nights in city B, or seven nights in city A and three nights in city B, we must first determine whether the total cost of hotels and fuel for each scenario is less than or equal to $4200.

Given that the estimated cost of fuel is $200, the cost of hotels must be less than or equal to $4000.

The following equations calculate the cost of hotels for each scenario:

3x + 6y = cost of hotels for spending 3 nights in city A and 6 nights in city B7x + 3y = cost of hotels for spending 7 nights in city A and 3 nights in city B

We also know that the club can only spend a total of 10 nights, so x + y must be less than or equal to 10.

Finally, we must ensure that the club can book four rooms each night. This means that the number of rooms required per night in each city is four times the number of nights. As a result, we must have:

4x ≤ number of available rooms in city A4y ≤ number of available rooms in city B

When we combine all of these constraints, we get the following system of linear equations:

3x + 6y + 200 ≤ 4200 (cost constraint for spending 3 nights in city A and 6 nights in city B)

7x + 3y + 200 ≤ 4200 (cost constraint for spending 7 nights in city A and 3 nights in city B)

x + y ≤ 10 (total number of nights constraint) (total number of nights constraint)

A city with 4x available rooms (room constraint for city A)

4y rooms available in city B (room constraint for city B)

To solve this system, we must first determine the number of available rooms in each city as well as the cost of hotel rooms per night. We can't tell if the club can spend three nights in city A and six nights in city B, or seven nights in city A and three nights in city B, without that information.

To learn more about cost.

https://brainly.com/question/19075809

#SPJ4

Multiply left-parenthesis x plus 2 right-parenthesis left-parenthesis x minus 6 right-parenthesis
Answer options
A.
x squared minus 8 x minus 12
B.
x squared plus 8 x minus 12
C.
x squared minus 4 x minus 12
D.
x squared plus 4 x minus 12
E.
x squared minus 4 x plus 12

Answers

Answer:

[tex]x^{2}-4x-12[/tex]

Step-by-step explanation:

(x+2)(x-6)

STEP 1 - USE FOIL

(FOIL is a standard way of multiplying 2 fractions, just multiply in the following order):

Forward

Outside

Inside

Last

(x+2)(x-6) becomes this when you FOIL it:

[tex](x^{2} )(-6x)(2x)(-12)[/tex]

STEP 2 - COMBINE ALL THE TERMS

[tex]x^{2}[/tex] has to stay by itself because there are no other squares. [tex]-6x+2x=-4x[/tex] because you're adding two to -6 which effectively is 6 - 2 but you're adding a negative sign. And [tex]-12[/tex] stays the same because there are no x's  in it.

STEP 3 - WRITE THE SOLUTION

All in all, the final solution, once you put everything together, is:

[tex]x^{2} -4x-12[/tex]

select the number that comes next in the sequence of numbers below 6 12 20 26 34 40

Answers

GIVE BRAINLIEST PLEASE!
thank you and have a good day :)

Answer:

48

Step-by-step explanation:

the sequence of numbers alternates between adding 6 and 8.

6 + 6 = 12

12 + 8 = 20

20 + 6 = 26

26 + 8 = 34

34 + 6 = 40

40 + 8 = 48!

i hope this helps :)

Answer:48

Step-by-step explanation:The sequence adds 6 first then adds 8

Sanjay made cookies for a bake sale and has tracked his sales by cookie shape. cat 36 star 14 dog 35 Considering this data, how many of the next 51 cookies sold should you expect to be in the shape of a dog?

Answers

The number of cookies sold that would be in the shape of the dog in the next 51 cookies is 21.

What is probability?

Probability refers to potential. A random event's occurrence is the subject of this area of mathematics. The range of the value is 0 to 1. Mathematics has incorporated probability to forecast the likelihood of various events. The degree to which something is likely to happen is basically what probability means. You will understand the potential outcomes for a random experiment using this fundamental theory of probability, which is also applied to the probability distribution. Knowing the total number of outcomes is necessary before we can calculate the likelihood that a specific event will occur.

The probability of cookies sold in shape of dog is:

P = 35/85

The number of cookies sold that would be in the shape of the dog in the next 51 cookies is:

N = 51 (P)

N = 51 (35/85)

N = 21

Hence, the number of cookies sold that would be in the shape of the dog in the next 51 cookies is 21.

Learn more about probability here:

https://brainly.com/question/30034780

#SPJ1

a gambler has a fair coin and a two-headed coin in his pocket. he selects one of the coins at random; when he flips it, it shows heads. what is the probability that it is the fair coin?

Answers

The probability of selecting the fair coin when a gambler has both a fair coin and a two-headed coin in his pocket is 50%.

This is because, when he selects one of the coins at random, it is equally likely that he has chosen either the fair coin or the two-headed coin. If he flips the coin and it shows heads, then the probability that it is the fair coin is still 50%, because either coin could have been selected and both would show heads.This is an example of a classical probability problem, which is based on the law of equal chances. This law states that when an event has multiple possible outcomes, each of those outcomes is equally likely to occur. In this case, there are two possible coins that could have been chosen, so each coin has a 50% chance of being selected. This means that the probability of selecting the fair coin is 50%.This also applies to events that have multiple outcomes which are not equally likely. For example, if a gambler has a fair coin, a two-headed coin, and a three-headed coin in his pocket, the probability of selecting the fair coin is still 50%. This is because the gambler has an equal chance of selecting any of the coins, regardless.

Learn more about probability here:

https://brainly.com/question/29381779

#SPJ4

the bakery made $600 Donuts they made 384 more Donuts than Bagels the bakery made 216 Bagels​

Answers

The bakery made 384 donuts and 216 bagels

What is bakery?

A bakery is a business that produces and sells baked goods, such as bread, cakes, pastries, and cookies.

Let's use the variable "x" to represent the number of bagels made.

From the problem, we know that:

The number of donuts made is 384 more than the number of bagels made, so the number of donuts is x + 384.

The bakery made 216 bagels.

We also know that the bakery made a total of 600 donuts. So, we can set up an equation to represent the total number of pastries made:

x + 384 + 216 = 600

Simplifying and solving for x:

x + 600 = 600

x = 600 - 600 + 384

x = 384

So, the bakery made 384 + 216 = 600 pastries in total.

Therefore, the bakery made 384 donuts and 216 bagels.

Learn more about Simplifying here : brainly.com/question/723406

#SPJ1

3x-1=5x+10x= 5 1/2
please explain to me what did i do wrong and correct it

Answers

The requried correct expression 3x - 1 + 5x + 10x = 5 1/2, and solution of the equation is x = 7.5/18

What are equation models?

The equation model is defined as the model of the given situation in the form of an equation using variables and constants.

The equation as written doesn't have a unique solution, as the left-hand side and right-hand side are not equal.

To correct the equation, you would need to provide more information about what you intended to do with the two equations and format the right-hand side of the equation properly. For example, if you meant to add the two equations, you could write,

3x - 1 + 5x + 10x = 5 + 2.5

18x = 7.5

x = 7.5/18

Learn more about models here:
https://brainly.com/question/22591166
#SPJ1

A little boy accidentally let go of his ballioon, and it floated away. It was 2 meters above the
ground when he let go, and it steadily rose 1 meter per second.
Write an equation that shows the relationship between the number of seconds since the boy
let the balloon go, x, and its elevation in meters, y.
y=

Answers

Answer:

Step-by-step explanation:

y=2+x

1m per second.

2+1x=2+x=y

find the relational column formula.

Fill in the missing term and select the
missing description. Simplify any fractions.
6(a + 2)
a + 2 =3
a =
Subtract 2 from both side

Answers

The value of a in the equation a + 2 = 3 is 1.

How to calculate the value

An equation simply has to do with the statement that illustrates the variables given. In this case, it is vital to note that two or more components are considered in order to be able to describe the scenario.

It is important to note that an equation is the mathematical statement which can be made up of two expressions which are connected by an equal sign.

a + 2 = 3

Subtract 2 from both sides

a + 2 - 2 = 3 - 2

a = 1

Learn more about equations on:

https://brainly.com/question/2972832

#SPJ1

please help i will mark as brainliest i promise

Answers

The triangles ΔGFN and ΔJFN are congruent to each other by the SAS postulate. Then ∠FGN = ∠FJN.

What is the triangle?

The polygonal shape of a triangle has a number of sides and three independent variables. Angles in the triangle add up to 180°.

The line segment GF = NJ and FN bisect the angle ∠GFJ.

In triangles ΔGFN and ΔJFN, then we have

GF = NJ                        (Given)

∠GFN = ∠JFN              (Given)

NF = NF                        (Common sides)

The triangles ΔGFN and ΔJFN are congruent to each other by the SAS postulate. Then we have

∠FGN = ∠FJN

More about the triangle link is given below.

https://brainly.com/question/25813512

#SPJ1

ANSWER QUICK!! I WILL GIVE BRAINLIEST!!!!!!!!!!!
The barber cuts 61 haircuts in 4 days. Determine the rate for a ratio of the two different quantities.

61 over 65 haircuts per day
4 over 65 haircuts per day
4 over 61 haircuts per day
61 over 4 haircuts per day

Answers

Answer:

61 over 4 haircuts per day

What is a ratio?

A ratio has two or more numbers that symbolize relation to each other. Ratios are used to compare numbers, and you can compare them using division.

A way to solve for the number of haircuts per day is to use this equation:

total number of haircuts ÷ number of days = haircuts per day

You could also use this fraction:

[tex]\frac{total-number-of-haircuts}{number-of-days}[/tex]

Inserting the numbers into the fraction::

[tex]\frac{61}{4}[/tex]

Therefore, the rate for a ratio using the two different quantities is 61 over 4 haircuts per day.

Solve for x.
X
A
=
2
C
1
B
1
E
X
D

Answers

Step-by-step explanation:

ABC and ADE are similar triangles.

that means they have the same angles, and there is one scaling factor for all sides from one triangle to the other.

so, we see that AB = 2, AD = 2+1 = 3

the scaling factor f from AB to AD is then

AB × f = AD

2 × f = 3

f = 3/2

the same scaling factor now applies between BC and DE (= x).

BC × f = x

1 × 3/2 = x

x = 3/2 = 1.5

What algebraic expression could represent the average of 2x, 3 + x and 6x?

Answers

The algebraic expression in simplified form representing the average is 3x + 1.

To solve this question, one must know the formula of average. It is as follows -

Average = sum of the numbers / quantity of numbers

Now, we see that there are 3 expressions in the question. Hence, quantity of numbers will be 3.

Sum of the numbers = 2x + 3 + x + 6x

So, keep the values in formula to find the expression -

Average = 2x + 3 + x + 6x/ 3

Simplifying the expression to find average

Average = 9x + 3/3

Performing division on Right Hand Side of the equation

Average = 3x + 1.

Hence, required algebraic expression is 3x + 1.

Learn more about average -

https://brainly.com/question/20118982

#SPJ4

Other Questions
the proper way to unplug a cord is to pull on the plug and not the cord. true/false If it takes 2 cups of rice to make 5 servings, how many cups of rice are needed to make 12 servings? Many Black Americans living in the North:O A. often faced segregation and discrimination.OB. faced the same hardships as those living in the South.OC. were subject to laws segregating public spaces based on race.D. didn't face segregation and discrimination. thomas think that 3 7/8 +2 11/12 is pretty close to 56 but lorinda thinks its is closer to 6. Todd disagree with both of them , and thinks it is closer to 7! what do you think? be clear and complete in youre response What is the purpose of cellular respiration?Transform sunlight into sugarTransform carbon dioxide into sugarTransform sugar into usable energyO Transform sugar into oxygen a baby passes its characteristics to his or her mother true or false? 6. Which is true of the DNA sequence of the MCR1 gene in Africa?a. The sequence is NOT very diverse in Africab. The sequence has lots of variation in Africa a forensic scientist is gathering materials to conduct a reinsch test. what is one material they will need? microscope oxygenated water copper strip rubber Carry out a research identifying 5 crops that are being cultivated in your area .Include observations A state of balance between cooperation and conflict is:________ All the mockingbirds that live in the same place at the same time make upa(n)O A. ecosystemOB. habitatOC. biomeOD. population What amino acids are involved in hydrogen bonds? PLEASE HELP QUICK!!! ILL GIVE BRAINLIESTRead the excerpt from the poem "The Arrow and the Song" by Henry Wadsworth Longfellow. Then answer the question that follows.I shot an arrow into the air,It fell to earth, I knew not where;For, so swiftly it flew, the sightCould not follow it in its flight.I breathed a song into the air,It fell to earth, I knew not where;For who has sight so keen and strong,That it can follow the flight of song?Long, long afterward, in an oakI found the arrow, still unbroke;And the song, from beginning to end,I found again in the heart of a friend.Which of the following statements best explains the poet's use of figurative language?Group of answer choicesThe poet incorporates personification to compare a poem to a hunter looking for a reader.The poet uses a metaphor to compare a poem to an arrow, saying that the writer never knows to whom it will mean something.The poet uses meiosis to understate the power of a good poem.The poet uses hyperbole to exaggerate the speed of an arrow when it is released by the bow. Older adults often experience which of the following Arteries always carry oxygenated blood away from the heart. (T/F) what is the composition in at% ag of an alloy that consists of 90.6 wt% ag and the remaining wt% cu? supply an answer that is rounded to the nearest 0.1 at%. What is one similarity between diffusion and osmosis? a nurse is using an iv port when administering medication to a client. which iv administration has the greatest potential to cause life-threatening changes? equation (2.1) says that trade between any two countries is proportional to the product of their gdps. does this mean that if the gdp of every country in the world doubled, world trade would quadruple? describe the short-term regulation of blood pressure. include sensor, control center, effectors and the actions of effectors to return blood pressure to homeostasis